Products 2306254-56-6
CAS 2306254-56-6 is the registry number for (1R,2S,5R)-8-Methyl-8-azabicyclo[3.2.1]octan-2-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine;dihydrochloride (CAS 2306254-56-6) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: (1R,2S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine;dihydrochloride. InChIKey: XXQOKZBMTJGBLW-ZEQLNYICSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (1R,2S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-2-amine;dihydrochloride |
| InChIKey | XXQOKZBMTJGBLW-ZEQLNYICSA-N |
| SMILES | CN1[C@@H]2CC[C@@H]([C@H]1CC2)N.Cl.Cl |
Computed by PubChem (NCBI)