CAS 2306260-92-2 appears in our catalog under these names: 2-(6-(tert-Butoxycarbonyl)-6-azaspiro(3.4)octan-2-yl)acetic acid, 2-(6-(tert-Butoxycarbonyl)-6-azaspiro(3.4)octan-2-yl)acetic acid, 98%, 2-{6-[(tert-butoxy)carbonyl]-6-azaspiro[3.4]octan-2-yl}acetic acid, 97%, 97%. Offered by: Biosynth, AmBeed, Chemat. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg, 500mg.
2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octan-2-yl]acetic acid (CAS 2306260-92-2) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octan-2-yl]acetic acid. InChIKey: SBKPRVNCJFNEIB-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 2-[6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azaspiro[3.4]octan-2-yl]acetic acid |
| InChIKey | SBKPRVNCJFNEIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CC(C2)CC(=O)O |
Computed by PubChem (NCBI)