Products 2306270-57-3
CAS 2306270-57-3 appears in our catalog under these names: O2-tert-butyl O5-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate, 95%, 95%, 2-(tert-Butyl) 5-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate, 95%, O2-tert-butyl O5-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate, 96%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 500mg.
2-O-tert-butyl 5-O-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate (CAS 2306270-57-3) is a chemical compound with the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. IUPAC name: 2-O-tert-butyl 5-O-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate. InChIKey: ZFUGLRADINWXRF-UHFFFAOYSA-N.
| Molecular formula | C14H23NO4 |
|---|---|
| Molecular weight | 269.34 g/mol |
| IUPAC name | 2-O-tert-butyl 5-O-methyl 2-azaspiro[3.4]octane-2,5-dicarboxylate |
| InChIKey | ZFUGLRADINWXRF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCCC2C(=O)OC |
Computed by PubChem (NCBI)