CAS 2309456-76-4 is the registry number for rac-(5S,8S)-8-(Propan-2-yl)-1,3-diazaspiro(4.5)decane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
8-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione (CAS 2309456-76-4) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: 8-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione. InChIKey: YGYGYMNTXAXUDV-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 8-propan-2-yl-1,3-diazaspiro[4.5]decane-2,4-dione |
| InChIKey | YGYGYMNTXAXUDV-UHFFFAOYSA-N |
| SMILES | CC(C)C1CCC2(CC1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)