Products 23122-65-8

CAS 23122-65-8 is the registry number for Methyl 3,4-dibromothiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3,4-dibromothiophene-2-carboxylate (CAS 23122-65-8) is a chemical compound with the molecular formula C6H4Br2O2S and a molecular weight of 299.97 g/mol. IUPAC name: methyl 3,4-dibromothiophene-2-carboxylate. InChIKey: KLDPHXSWZSAPOY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Br2O2S
Molecular weight299.97 g/mol
IUPAC namemethyl 3,4-dibromothiophene-2-carboxylate
InChIKeyKLDPHXSWZSAPOY-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CS1)Br)Br

Computed by PubChem (NCBI)