Products 856354-09-1

CAS 856354-09-1 appears in our catalog under these names: 3,5-Dibromo-4-methylthiophene-2-carboxylic acid, 95+%, 3,5-Dibromo-4-methylthiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3,5-dibromo-4-methylthiophene-2-carboxylic acid (CAS 856354-09-1) is a chemical compound with the molecular formula C6H4Br2O2S and a molecular weight of 299.97 g/mol. IUPAC name: 3,5-dibromo-4-methylthiophene-2-carboxylic acid. InChIKey: FCFZMWHMDWYVTH-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Br2O2S
Molecular weight299.97 g/mol
IUPAC name3,5-dibromo-4-methylthiophene-2-carboxylic acid
InChIKeyFCFZMWHMDWYVTH-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1Br)C(=O)O)Br

Computed by PubChem (NCBI)