Products 62224-21-9

CAS 62224-21-9 is the registry number for Methyl 3,5-dibromo-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 3,5-dibromothiophene-2-carboxylate (CAS 62224-21-9) is a chemical compound with the molecular formula C6H4Br2O2S and a molecular weight of 299.97 g/mol. IUPAC name: methyl 3,5-dibromothiophene-2-carboxylate. InChIKey: LVSJAZBOGSEUKI-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4Br2O2S
Molecular weight299.97 g/mol
IUPAC namemethyl 3,5-dibromothiophene-2-carboxylate
InChIKeyLVSJAZBOGSEUKI-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(S1)Br)Br

Computed by PubChem (NCBI)