CAS 23131-47-7 is the registry number for 2-(1,3-Dioxaindan-5-yl)-2-methylpropan-1-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-(1,3-benzodioxol-5-yl)-2-methylpropan-1-amine (CAS 23131-47-7) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-yl)-2-methylpropan-1-amine. InChIKey: CGZCCWRCOLWZKV-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-yl)-2-methylpropan-1-amine |
| InChIKey | CGZCCWRCOLWZKV-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)