CAS 23145-65-5 appears in our catalog under these names: 4-(Bromomethyl)-2-methoxy-1-nitrobenzene, 95%, 3-Methoxy-4-nitrobenzyl bromide, 95%, 3-Methoxy-4-nitrobenzyl bromide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
4-(bromomethyl)-2-methoxy-1-nitrobenzene (CAS 23145-65-5) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 4-(bromomethyl)-2-methoxy-1-nitrobenzene. InChIKey: ZDMISTLJKQDGTB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 4-(bromomethyl)-2-methoxy-1-nitrobenzene |
| InChIKey | ZDMISTLJKQDGTB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)