CAS 23147-77-5 is the registry number for 4-Benzyl-3,5-dimethyl-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
4-benzyl-3,5-dimethyl-1H-pyrazole (CAS 23147-77-5) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 4-benzyl-3,5-dimethyl-1H-pyrazole. InChIKey: DYXNQVLCTOFNRG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 4-benzyl-3,5-dimethyl-1H-pyrazole |
| InChIKey | DYXNQVLCTOFNRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)