CAS 23186-94-9 appears in our catalog under these names: Butamirate Impurity 10, 5,5-Dibenzylimidazolidine-2,4-dione. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5g, 0,5g.
5,5-dibenzylimidazolidine-2,4-dione (CAS 23186-94-9) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 5,5-dibenzylimidazolidine-2,4-dione. InChIKey: RKEFYRGLENJHMY-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | 5,5-dibenzylimidazolidine-2,4-dione |
| InChIKey | RKEFYRGLENJHMY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2(C(=O)NC(=O)N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)