Products 23197-74-2
CAS 23197-74-2 is the registry number for Methyl 2,2-Bis(4-bromophenyl)-2-hydroxyacetate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 2,2-bis(4-bromophenyl)-2-hydroxyacetate (CAS 23197-74-2) is a chemical compound with the molecular formula C15H12Br2O3 and a molecular weight of 400.06 g/mol. IUPAC name: methyl 2,2-bis(4-bromophenyl)-2-hydroxyacetate. InChIKey: GADZBVQESIUGQE-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2O3 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | methyl 2,2-bis(4-bromophenyl)-2-hydroxyacetate |
| InChIKey | GADZBVQESIUGQE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Br)(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)