CAS 35031-47-1 is the registry number for 2-(Benzyloxy)-3,5-dibromo-4-methoxybenzaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dibromo-4-methoxy-2-phenylmethoxybenzaldehyde (CAS 35031-47-1) is a chemical compound with the molecular formula C15H12Br2O3 and a molecular weight of 400.06 g/mol. IUPAC name: 3,5-dibromo-4-methoxy-2-phenylmethoxybenzaldehyde. InChIKey: YSMHWFQEABEUIN-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2O3 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 3,5-dibromo-4-methoxy-2-phenylmethoxybenzaldehyde |
| InChIKey | YSMHWFQEABEUIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1Br)OCC2=CC=CC=C2)C=O)Br |
Computed by PubChem (NCBI)