CAS 380170-12-7 appears in our catalog under these names: 4-(2,6-Dibromo-4-methyl-phenoxymethyl)-benzoic acid, 95%, 4-((2,6-Dibromo-4-methylphenoxy)methyl)benzoic acid, 97%, 4-(2,6-Dibromo-4-methylphenoxymethyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoic acid (CAS 380170-12-7) is a chemical compound with the molecular formula C15H12Br2O3 and a molecular weight of 400.06 g/mol. IUPAC name: 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoic acid. InChIKey: UDOOBWSBFFWDRJ-UHFFFAOYSA-N.
| Molecular formula | C15H12Br2O3 |
|---|---|
| Molecular weight | 400.06 g/mol |
| IUPAC name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzoic acid |
| InChIKey | UDOOBWSBFFWDRJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCC2=CC=C(C=C2)C(=O)O)Br |
Computed by PubChem (NCBI)