Products 2322535-50-0
CAS 2322535-50-0 is the registry number for (4R)-chromane-4-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4R)-3,4-dihydro-2H-chromene-4-carboxylic acid (CAS 2322535-50-0) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: (4R)-3,4-dihydro-2H-chromene-4-carboxylic acid. InChIKey: RGWHTTALQBHDGZ-MRVPVSSYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | (4R)-3,4-dihydro-2H-chromene-4-carboxylic acid |
| InChIKey | RGWHTTALQBHDGZ-MRVPVSSYSA-N |
| SMILES | C1COC2=CC=CC=C2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)