Products 2322582-82-9
CAS 2322582-82-9 is the registry number for tert-Butyl (S)-1-amino-6-azaspiro[2.5]octane-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (2S)-2-amino-6-azaspiro[2.5]octane-6-carboxylate (CAS 2322582-82-9) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (2S)-2-amino-6-azaspiro[2.5]octane-6-carboxylate. InChIKey: QZRDFJCRLZNCPN-VIFPVBQESA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-6-azaspiro[2.5]octane-6-carboxylate |
| InChIKey | QZRDFJCRLZNCPN-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C[C@@H]2N |
Computed by PubChem (NCBI)