CAS 2322832-98-2 is the registry number for 4,7,8-Trichloroquinolin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7,8-trichloro-1H-quinolin-2-one (CAS 2322832-98-2) is a chemical compound with the molecular formula C9H4Cl3NO and a molecular weight of 248.5 g/mol. IUPAC name: 4,7,8-trichloro-1H-quinolin-2-one. InChIKey: DDDYVFDNGGHNQN-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3NO |
|---|---|
| Molecular weight | 248.5 g/mol |
| IUPAC name | 4,7,8-trichloro-1H-quinolin-2-one |
| InChIKey | DDDYVFDNGGHNQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=CC(=O)N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)