CAS 2364585-18-0 appears in our catalog under these names: 5-(2,4,6-Trichlorophenyl)oxazole, 95%, 5-(2,4,6-Trichlorophenyl)oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-(2,4,6-trichlorophenyl)-1,3-oxazole (CAS 2364585-18-0) is a chemical compound with the molecular formula C9H4Cl3NO and a molecular weight of 248.5 g/mol. IUPAC name: 5-(2,4,6-trichlorophenyl)-1,3-oxazole. InChIKey: OGYYEQSPUFFPCC-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3NO |
|---|---|
| Molecular weight | 248.5 g/mol |
| IUPAC name | 5-(2,4,6-trichlorophenyl)-1,3-oxazole |
| InChIKey | OGYYEQSPUFFPCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C2=CN=CO2)Cl)Cl |
Computed by PubChem (NCBI)