CAS 306937-25-7 is the registry number for 4,6-Dichloro-1H-indole-2-carbonyl chloride, 88%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4,6-dichloro-1H-indole-2-carbonyl chloride (CAS 306937-25-7) is a chemical compound with the molecular formula C9H4Cl3NO and a molecular weight of 248.5 g/mol. IUPAC name: 4,6-dichloro-1H-indole-2-carbonyl chloride. InChIKey: ZNJASLMFOWLAOR-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3NO |
|---|---|
| Molecular weight | 248.5 g/mol |
| IUPAC name | 4,6-dichloro-1H-indole-2-carbonyl chloride |
| InChIKey | ZNJASLMFOWLAOR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=C2)C(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)