Products 2323062-57-1

CAS 2323062-57-1 is the registry number for (S)-Methyl azepane-2-carboxylate hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (2S)-azepane-2-carboxylate;hydrochloride (CAS 2323062-57-1) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (2S)-azepane-2-carboxylate;hydrochloride. InChIKey: BNHXNHZLTSGLMV-FJXQXJEOSA-N.

Identity
Molecular formulaC8H16ClNO2
Molecular weight193.67 g/mol
IUPAC namemethyl (2S)-azepane-2-carboxylate;hydrochloride
InChIKeyBNHXNHZLTSGLMV-FJXQXJEOSA-N
SMILESCOC(=O)[C@@H]1CCCCCN1.Cl

Computed by PubChem (NCBI)