CAS 2323063-19-8 is the registry number for (S)-7-Hydroxychromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-7-hydroxy-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 2323063-19-8) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: (3S)-7-hydroxy-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: PXISEHYLCCXPQG-ZETCQYMHSA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (3S)-7-hydroxy-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | PXISEHYLCCXPQG-ZETCQYMHSA-N |
| SMILES | C1[C@@H](COC2=C1C=CC(=C2)O)C(=O)O |
Computed by PubChem (NCBI)