Products 2323525-19-3
CAS 2323525-19-3 appears in our catalog under these names: uPSEM792, uPSEM792, 99.92%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 5 mg, 25 mg, 10 mg.
5-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one (CAS 2323525-19-3) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: 5-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one. InChIKey: UEUFVUIOCKHRTA-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | 5-methyl-5,8,14-triazatetracyclo[10.3.1.02,11.04,9]hexadeca-2,4(9),7,10-tetraen-6-one |
| InChIKey | UEUFVUIOCKHRTA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C3C4CC(C3=C2)CNC4)N=CC1=O |
Computed by PubChem (NCBI)
Synonyms:
uPSEM792, orb3133536