Products 23242-84-4
CAS 23242-84-4 is the registry number for 1-Methyl 2-(diphenylmethylene)butanedioate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-methoxycarbonyl-4,4-diphenylbut-3-enoic acid (CAS 23242-84-4) is a chemical compound with the molecular formula C18H16O4 and a molecular weight of 296.3 g/mol. IUPAC name: 3-methoxycarbonyl-4,4-diphenylbut-3-enoic acid. InChIKey: DJQWQMZLUOHZAC-UHFFFAOYSA-N.
| Molecular formula | C18H16O4 |
|---|---|
| Molecular weight | 296.3 g/mol |
| IUPAC name | 3-methoxycarbonyl-4,4-diphenylbut-3-enoic acid |
| InChIKey | DJQWQMZLUOHZAC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C(C1=CC=CC=C1)C2=CC=CC=C2)CC(=O)O |
Computed by PubChem (NCBI)