CAS 232595-93-6 is the registry number for 4-(3-Bromophenyl)oxane-2,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-bromophenyl)oxane-2,6-dione (CAS 232595-93-6) is a chemical compound with the molecular formula C11H9BrO3 and a molecular weight of 269.09 g/mol. IUPAC name: 4-(3-bromophenyl)oxane-2,6-dione. InChIKey: YWVLFVQHEWEATF-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO3 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 4-(3-bromophenyl)oxane-2,6-dione |
| InChIKey | YWVLFVQHEWEATF-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)OC1=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)