CAS 23269-91-2 is the registry number for 5-(3,4-Dimethoxyphenyl)-1,3,4-oxadiazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(3,4-dimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 23269-91-2) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: LYWWVVSCYDBFCO-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | LYWWVVSCYDBFCO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC(=S)O2)OC |
Computed by PubChem (NCBI)