CAS 52996-36-8 is the registry number for 2,3-Dimethyl-6-quinoxalinesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
2,3-dimethylquinoxaline-6-sulfonic acid (CAS 52996-36-8) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: 2,3-dimethylquinoxaline-6-sulfonic acid. InChIKey: HHKUJCYZVGDUNW-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 2,3-dimethylquinoxaline-6-sulfonic acid |
| InChIKey | HHKUJCYZVGDUNW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)S(=O)(=O)O)C |
Computed by PubChem (NCBI)