Products 52996-36-8

CAS 52996-36-8 is the registry number for 2,3-Dimethyl-6-quinoxalinesulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

2,3-dimethylquinoxaline-6-sulfonic acid (CAS 52996-36-8) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: 2,3-dimethylquinoxaline-6-sulfonic acid. InChIKey: HHKUJCYZVGDUNW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O3S
Molecular weight238.27 g/mol
IUPAC name2,3-dimethylquinoxaline-6-sulfonic acid
InChIKeyHHKUJCYZVGDUNW-UHFFFAOYSA-N
SMILESCC1=C(N=C2C=C(C=CC2=N1)S(=O)(=O)O)C

Computed by PubChem (NCBI)