CAS 923178-66-9 is the registry number for N-Methoxy-3-oxo-3,4-dihydro-2H-benzo[b][1,4]thiazine-6-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-methoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide (CAS 923178-66-9) is a chemical compound with the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. IUPAC name: N-methoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide. InChIKey: KLGYACHEJIEHBJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | N-methoxy-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| InChIKey | KLGYACHEJIEHBJ-UHFFFAOYSA-N |
| SMILES | CONC(=O)C1=CC2=C(C=C1)SCC(=O)N2 |
Computed by PubChem (NCBI)