CAS 23275-52-7 is the registry number for 5-(4-Methoxyphenyl)-1,2,4-oxadiazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-amine (CAS 23275-52-7) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-amine. InChIKey: XKJZMTPVMCKYKA-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-amine |
| InChIKey | XKJZMTPVMCKYKA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NO2)N |
Computed by PubChem (NCBI)