CAS 233261-84-2 is the registry number for 1-((2-Chlorophenyl)sulfonyl)piperazine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
1-(2-chlorophenyl)sulfonylpiperazine (CAS 233261-84-2) is a chemical compound with the molecular formula C10H13ClN2O2S and a molecular weight of 260.74 g/mol. IUPAC name: 1-(2-chlorophenyl)sulfonylpiperazine. InChIKey: BVKKRWPRNWNKTH-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O2S |
|---|---|
| Molecular weight | 260.74 g/mol |
| IUPAC name | 1-(2-chlorophenyl)sulfonylpiperazine |
| InChIKey | BVKKRWPRNWNKTH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)