CAS 2338-85-4 is the registry number for 2,3,3-Trifluoro-1-phenylprop-2-en-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,3,3-trifluoro-1-phenylprop-2-en-1-ol (CAS 2338-85-4) is a chemical compound with the molecular formula C9H7F3O and a molecular weight of 188.15 g/mol. IUPAC name: 2,3,3-trifluoro-1-phenylprop-2-en-1-ol. InChIKey: NMOVVCHJYUDXTN-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O |
|---|---|
| Molecular weight | 188.15 g/mol |
| IUPAC name | 2,3,3-trifluoro-1-phenylprop-2-en-1-ol |
| InChIKey | NMOVVCHJYUDXTN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=C(F)F)F)O |
Computed by PubChem (NCBI)