Products 23403-54-5
CAS 23403-54-5 appears in our catalog under these names: alpha-D-glucose-d7, 99%, D-glucose-1,2,3,4,5,6,6-D7, 97 atom % D, alpha-D-glucose-d7, 97%. Offered by: MedChemExpress, Sigma-Aldrich, Chemat. Available pack sizes: 10 mg, 100 mg, 25 mg, 5 mg, 50 mg, 100MG, 10G, 1G.
(3R,4S,5S,6R)-2,3,4,5,6-pentadeuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol (CAS 23403-54-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 187.20 g/mol. IUPAC name: (3R,4S,5S,6R)-2,3,4,5,6-pentadeuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-QCQRZMBHSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 187.20 g/mol |
| IUPAC name | (3R,4S,5S,6R)-2,3,4,5,6-pentadeuterio-6-[dideuterio(hydroxy)methyl]oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-QCQRZMBHSA-N |
| SMILES | [2H][C@@]1([C@]([C@@](OC([C@]1([2H])O)([2H])O)([2H])C([2H])([2H])O)([2H])O)O |
Computed by PubChem (NCBI)