CAS 23417-61-0 appears in our catalog under these names: 6-Chloronaphthalen-2-amine, 97%, 6-Chloronaphthalen-2-amine 97%. Offered by: AmBeed. Available pack sizes: 1g, 50mg, 100mg, 250mg.
6-chloronaphthalen-2-amine (CAS 23417-61-0) is a chemical compound with the molecular formula C10H8ClN and a molecular weight of 177.63 g/mol. IUPAC name: 6-chloronaphthalen-2-amine. InChIKey: NKYFZBWHIXNTKV-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN |
|---|---|
| Molecular weight | 177.63 g/mol |
| IUPAC name | 6-chloronaphthalen-2-amine |
| InChIKey | NKYFZBWHIXNTKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Cl)C=C1N |
Computed by PubChem (NCBI)