Products 2344678-54-0

CAS 2344678-54-0 is the registry number for Methyl 5,5-dimethylmorpholine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5,5-dimethylmorpholine-3-carboxylate;hydrochloride (CAS 2344678-54-0) is a chemical compound with the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. IUPAC name: methyl 5,5-dimethylmorpholine-3-carboxylate;hydrochloride. InChIKey: HSLFXCUUIOKBIK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO3
Molecular weight209.67 g/mol
IUPAC namemethyl 5,5-dimethylmorpholine-3-carboxylate;hydrochloride
InChIKeyHSLFXCUUIOKBIK-UHFFFAOYSA-N
SMILESCC1(COCC(N1)C(=O)OC)C.Cl

Computed by PubChem (NCBI)