Products 2344678-65-3

CAS 2344678-65-3 is the registry number for rac- tert-Butyl N-((1R,3R)-3-(cyanomethyl)cyclobutyl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[3-(cyanomethyl)cyclobutyl]carbamate (CAS 2344678-65-3) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl N-[3-(cyanomethyl)cyclobutyl]carbamate. InChIKey: CGRMLTVZKMRNRN-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18N2O2
Molecular weight210.27 g/mol
IUPAC nametert-butyl N-[3-(cyanomethyl)cyclobutyl]carbamate
InChIKeyCGRMLTVZKMRNRN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1CC(C1)CC#N

Computed by PubChem (NCBI)