Products 2344856-26-2
CAS 2344856-26-2 is the registry number for N1-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine (CAS 2344856-26-2) is a chemical compound with the molecular formula C13H21BN2O2 and a molecular weight of 248.13 g/mol. IUPAC name: 2-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine. InChIKey: HFJQEMKQEWBTGS-UHFFFAOYSA-N.
| Molecular formula | C13H21BN2O2 |
|---|---|
| Molecular weight | 248.13 g/mol |
| IUPAC name | 2-N-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene-1,2-diamine |
| InChIKey | HFJQEMKQEWBTGS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)NC |
Computed by PubChem (NCBI)