CAS 2349411-92-1 is the registry number for 7-Bromo-2-chloroquinazolin-4-ol 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-2-chloro-3H-quinazolin-4-one (CAS 2349411-92-1) is a chemical compound with the molecular formula C8H4BrClN2O and a molecular weight of 259.49 g/mol. IUPAC name: 7-bromo-2-chloro-3H-quinazolin-4-one. InChIKey: YPHTXSWJCJHDKU-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2O |
|---|---|
| Molecular weight | 259.49 g/mol |
| IUPAC name | 7-bromo-2-chloro-3H-quinazolin-4-one |
| InChIKey | YPHTXSWJCJHDKU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(NC2=O)Cl |
Computed by PubChem (NCBI)