Products 2349760-99-0
CAS 2349760-99-0 is the registry number for (2R)-2-(1-acetyl-4-piperidyl)-2-(tert-butoxycarbonylamino)acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(2R)-2-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 2349760-99-0) is a chemical compound with the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. IUPAC name: (2R)-2-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: QNBHGDBGVWHRET-LLVKDONJSA-N.
| Molecular formula | C14H24N2O5 |
|---|---|
| Molecular weight | 300.35 g/mol |
| IUPAC name | (2R)-2-(1-acetylpiperidin-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | QNBHGDBGVWHRET-LLVKDONJSA-N |
| SMILES | CC(=O)N1CCC(CC1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)