Products 2708278-52-6
CAS 2708278-52-6 appears in our catalog under these names: Di-tert-butyl 2-oxopiperazine-1,4-dicarboxylate, 98%, 98%, Di-tert-butyl 2-oxopiperazine-1,4-dicarboxylate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Ditert-butyl 2-oxopiperazine-1,4-dicarboxylate (CAS 2708278-52-6) is a chemical compound with the molecular formula C14H24N2O5 and a molecular weight of 300.35 g/mol. IUPAC name: ditert-butyl 2-oxopiperazine-1,4-dicarboxylate. InChIKey: CPIYXSXNLNRDIN-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O5 |
|---|---|
| Molecular weight | 300.35 g/mol |
| IUPAC name | ditert-butyl 2-oxopiperazine-1,4-dicarboxylate |
| InChIKey | CPIYXSXNLNRDIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)