Products 2349906-34-7
CAS 2349906-34-7 is the registry number for (S)-2-(Boc-amino)-3-(2,6-dimethoxyphenyl)propanoic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(2,6-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 2349906-34-7) is a chemical compound with the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. IUPAC name: (2S)-3-(2,6-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZVZLYFJFIWGKNS-NSHDSACASA-N.
| Molecular formula | C16H23NO6 |
|---|---|
| Molecular weight | 325.36 g/mol |
| IUPAC name | (2S)-3-(2,6-dimethoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZVZLYFJFIWGKNS-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=C(C=CC=C1OC)OC)C(=O)O |
Computed by PubChem (NCBI)