Products 2349974-85-0
CAS 2349974-85-0 is the registry number for Fmoc-β-D-Nle(F3)-OH, 97%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid (CAS 2349974-85-0) is a chemical compound with the molecular formula C21H20F3NO4 and a molecular weight of 407.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid. InChIKey: VUFBGDMSNLMQNO-CYBMUJFWSA-N.
| Molecular formula | C21H20F3NO4 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid |
| InChIKey | VUFBGDMSNLMQNO-CYBMUJFWSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(F)(F)F)CC(=O)O |
Computed by PubChem (NCBI)