Products 2996062-20-3
CAS 2996062-20-3 is the registry number for Neuroprotective agent 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
Benzyl 3-(2-methoxy-2-oxoethyl)-3-[4-(trifluoromethyl)phenyl]azetidine-1-carboxylate (CAS 2996062-20-3) is a chemical compound with the molecular formula C21H20F3NO4 and a molecular weight of 407.4 g/mol. IUPAC name: benzyl 3-(2-methoxy-2-oxoethyl)-3-[4-(trifluoromethyl)phenyl]azetidine-1-carboxylate. InChIKey: YONPJWQIXOUOGK-UHFFFAOYSA-N.
| Molecular formula | C21H20F3NO4 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | benzyl 3-(2-methoxy-2-oxoethyl)-3-[4-(trifluoromethyl)phenyl]azetidine-1-carboxylate |
| InChIKey | YONPJWQIXOUOGK-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(CN(C1)C(=O)OCC2=CC=CC=C2)C3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Neuroprotective agent 2, orb2565686