Products 2350066-08-7
CAS 2350066-08-7 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6,6,6-trifluorohexanoic acid, 95%+, 95%+, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-6,6,6-trifluorohexanoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid (CAS 2350066-08-7) is a chemical compound with the molecular formula C21H20F3NO4 and a molecular weight of 407.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid. InChIKey: RVXLFAQYYCBCAT-GOSISDBHSA-N.
| Molecular formula | C21H20F3NO4 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6,6,6-trifluorohexanoic acid |
| InChIKey | RVXLFAQYYCBCAT-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)