Products 2349991-04-2
CAS 2349991-04-2 is the registry number for Fmoc-Phe(2-Cl, 5-F)-OH, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-3-(2-chloro-5-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2349991-04-2) is a chemical compound with the molecular formula C24H19ClFNO4 and a molecular weight of 439.9 g/mol. IUPAC name: (2S)-3-(2-chloro-5-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: CIIPCRWYTUOPTO-QFIPXVFZSA-N.
| Molecular formula | C24H19ClFNO4 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | (2S)-3-(2-chloro-5-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | CIIPCRWYTUOPTO-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C=CC(=C4)F)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Phe(2-Cl, 5-F)-OH