Products 2350-31-4

CAS 2350-31-4 is the registry number for Proparacaine Impurity 19 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl-[2-(4-propoxybenzoyl)oxyethyl]azanium chloride (CAS 2350-31-4) is a chemical compound with the molecular formula C16H26ClNO3 and a molecular weight of 315.83 g/mol. IUPAC name: diethyl-[2-(4-propoxybenzoyl)oxyethyl]azanium chloride. InChIKey: GNSZNRNDSFDWCP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H26ClNO3
Molecular weight315.83 g/mol
IUPAC namediethyl-[2-(4-propoxybenzoyl)oxyethyl]azanium chloride
InChIKeyGNSZNRNDSFDWCP-UHFFFAOYSA-N
SMILESCCCOC1=CC=C(C=C1)C(=O)OCC[NH+](CC)CC.[Cl-]

Computed by PubChem (NCBI)