CAS 2915675-56-6 is the registry number for SORT1-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[(3-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid;hydrochloride (CAS 2915675-56-6) is a chemical compound with the molecular formula C16H26ClNO3 and a molecular weight of 315.83 g/mol. IUPAC name: (2S)-2-[(3-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid;hydrochloride. InChIKey: FDRFBFOTLBDFMP-UQKRIMTDSA-N.
| Molecular formula | C16H26ClNO3 |
|---|---|
| Molecular weight | 315.83 g/mol |
| IUPAC name | (2S)-2-[(3-methoxyphenyl)methylamino]-5,5-dimethylhexanoic acid;hydrochloride |
| InChIKey | FDRFBFOTLBDFMP-UQKRIMTDSA-N |
| SMILES | CC(C)(C)CC[C@@H](C(=O)O)NCC1=CC(=CC=C1)OC.Cl |
Computed by PubChem (NCBI)