Products 273398-39-3
CAS 273398-39-3 appears in our catalog under these names: Tramadol Impurity 3, Rac-4-Hydroxycyclohexyl Tramadol Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(1R,2R,4S)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-diol;hydrochloride (CAS 273398-39-3) is a chemical compound with the molecular formula C16H26ClNO3 and a molecular weight of 315.83 g/mol. IUPAC name: (1R,2R,4S)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-diol;hydrochloride. InChIKey: AYUBUCOVRQQXPD-FNIUFUSKSA-N.
| Molecular formula | C16H26ClNO3 |
|---|---|
| Molecular weight | 315.83 g/mol |
| IUPAC name | (1R,2R,4S)-2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-diol;hydrochloride |
| InChIKey | AYUBUCOVRQQXPD-FNIUFUSKSA-N |
| SMILES | CN(C)C[C@H]1C[C@H](CC[C@@]1(C2=CC(=CC=C2)OC)O)O.Cl |
Computed by PubChem (NCBI)