Products 23503-67-5

CAS 23503-67-5 is the registry number for 2-(Methylsulfonyl)-10H-phenothiazine 5-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methylsulfonyl-10H-phenothiazine 5-oxide (CAS 23503-67-5) is a chemical compound with the molecular formula C13H11NO3S2 and a molecular weight of 293.4 g/mol. IUPAC name: 2-methylsulfonyl-10H-phenothiazine 5-oxide. InChIKey: AXXNWUFBQXDIQU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO3S2
Molecular weight293.4 g/mol
IUPAC name2-methylsulfonyl-10H-phenothiazine 5-oxide
InChIKeyAXXNWUFBQXDIQU-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC2=C(C=C1)S(=O)C3=CC=CC=C3N2

Computed by PubChem (NCBI)