CAS 23503-67-5 is the registry number for 2-(Methylsulfonyl)-10H-phenothiazine 5-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfonyl-10H-phenothiazine 5-oxide (CAS 23503-67-5) is a chemical compound with the molecular formula C13H11NO3S2 and a molecular weight of 293.4 g/mol. IUPAC name: 2-methylsulfonyl-10H-phenothiazine 5-oxide. InChIKey: AXXNWUFBQXDIQU-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 2-methylsulfonyl-10H-phenothiazine 5-oxide |
| InChIKey | AXXNWUFBQXDIQU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)S(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)