Products 444166-47-6

CAS 444166-47-6 appears in our catalog under these names: 4-(2-(Thiophen-2-ylsulfanyl)acetamido)benzoic acid, 95%, 4-(2-(Thiophen-2-ylsulfanyl)acetamido)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid (CAS 444166-47-6) is a chemical compound with the molecular formula C13H11NO3S2 and a molecular weight of 293.4 g/mol. IUPAC name: 4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid. InChIKey: UJEKCJKPAJYFHL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11NO3S2
Molecular weight293.4 g/mol
IUPAC name4-[(2-thiophen-2-ylsulfanylacetyl)amino]benzoic acid
InChIKeyUJEKCJKPAJYFHL-UHFFFAOYSA-N
SMILESC1=CSC(=C1)SCC(=O)NC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)