CAS 561001-98-7 is the registry number for 3-((4,5-Dihydro-1,3-thiazol-2-ylsulfanyl)methyl)-1-benzofuran-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid (CAS 561001-98-7) is a chemical compound with the molecular formula C13H11NO3S2 and a molecular weight of 293.4 g/mol. IUPAC name: 3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid. InChIKey: MUTTZZSYBHMTSC-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3S2 |
|---|---|
| Molecular weight | 293.4 g/mol |
| IUPAC name | 3-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-1-benzofuran-2-carboxylic acid |
| InChIKey | MUTTZZSYBHMTSC-UHFFFAOYSA-N |
| SMILES | C1CSC(=N1)SCC2=C(OC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)