CAS 235106-84-0 is the registry number for 3,3'-((4-Methoxyphenyl)methylene)bis(4-methoxybenzaldehyde. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
3-[(5-formyl-2-methoxyphenyl)-(4-methoxyphenyl)methyl]-4-methoxybenzaldehyde (CAS 235106-84-0) is a chemical compound with the molecular formula C24H22O5 and a molecular weight of 390.4 g/mol. IUPAC name: 3-[(5-formyl-2-methoxyphenyl)-(4-methoxyphenyl)methyl]-4-methoxybenzaldehyde. InChIKey: SCRMCRPZPBZVMB-UHFFFAOYSA-N.
| Molecular formula | C24H22O5 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 3-[(5-formyl-2-methoxyphenyl)-(4-methoxyphenyl)methyl]-4-methoxybenzaldehyde |
| InChIKey | SCRMCRPZPBZVMB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=C(C=CC(=C2)C=O)OC)C3=C(C=CC(=C3)C=O)OC |
Computed by PubChem (NCBI)